C25H32ClFO5 — CID 88726229
[(8S,9R,10S,11S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 2-methylpropanoate (PubChem CID 88726229) has the molecular formula C25H32ClFO5 and a molecular weight of 466.98 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 2-methylpropanoate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 88726229 |
| Molecular Formula | C25H32ClFO5 |
| Molecular Weight | 466.98 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17R)-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@]1(C(=O)CCl)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C25H32ClFO5/c1-14(2)21(31)32-24(20(30)13-26)10-8-17-18-6-5-15-11-16(28)7-9-22(15,3)25(18,27)19(29)12-23(17,24)4/h7,9,11,14,17-19,29H,5-6,8,10,12-13H2,1-4H3/t17-,18-,19-,22-,23-,24-,25-/m0/s1 |
| InChIKey | JSJKFVXQDIXUNM-ZLOBPOPUSA-N |
| XLogP | 4.10 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|