C33H37FO4S2 — CID 88684209
(8S,9R,10S,11S,13S,14S)-9-fluoro-11-hydroxy-17,17-bis[(4-methoxyphenyl)sulfanyl]-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88684209) has the molecular formula C33H37FO4S2 and a molecular weight of 580.79 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S)-9-fluoro-11-hydroxy-17,17-bis[(4-methoxyphenyl)sulfanyl]-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,11S,13S,14S)-9-fluoro-11-hydroxy-17,17-bis[(4-methoxyphenyl)sulfanyl]-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88684209 |
| Molecular Formula | C33H37FO4S2 |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S)-9-fluoro-11-hydroxy-17,17-bis[(4-methoxyphenyl)sulfanyl]-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | COc1ccc(SC2(Sc3ccc(OC)cc3)CC[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)[C@@]4(F)[C@@H](O)C[C@@]32C)cc1 |
| InChI | InChI=1S/C33H37FO4S2/c1-30-17-15-22(35)19-21(30)5-14-28-27-16-18-32(31(27,2)20-29(36)33(28,30)34,39-25-10-6-23(37-3)7-11-25)40-26-12-8-24(38-4)9-13-26/h6-13,15,17,19,27-29,36H,5,14,16,18,20H2,1-4H3/t27-,28-,29-,30-,31-,33-/m0/s1 |
| InChIKey | TUQXBBVYXHAVND-YYTVJKPMSA-N |
| XLogP | 7.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|