C22H30FNO3S2 — CID 88712988
2-[[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]sulfanyl]acetamide (PubChem CID 88712988) has the molecular formula C22H30FNO3S2 and a molecular weight of 439.62 g/mol. Its IUPAC name is 2-[[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]sulfanyl]acetamide.
| Compound Name | 2-[[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 88712988 |
| Molecular Formula | C22H30FNO3S2 |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-[[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]sulfanyl]acetamide |
| SMILES | CS[C@@]1(SCC(N)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C22H30FNO3S2/c1-19-8-6-14(25)10-13(19)4-5-16-15-7-9-21(28-3,29-12-18(24)27)20(15,2)11-17(26)22(16,19)23/h6,8,10,15-17,26H,4-5,7,9,11-12H2,1-3H3,(H2,24,27)/t15-,16-,17-,19-,20-,21+,22-/m0/s1 |
| InChIKey | HDSPWLKKCYECRE-OAUGPMCWSA-N |
| XLogP | 3.63 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|