C24H33FO3S2 — CID 54139384
[(8S,10S,11S,13S,14S)-17-ethylsulfanyl-9-fluoro-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-11-yl] acetate (PubChem CID 54139384) has the molecular formula C24H33FO3S2 and a molecular weight of 452.66 g/mol. Its IUPAC name is [(8S,10S,11S,13S,14S)-17-ethylsulfanyl-9-fluoro-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-11-yl] acetate.
| Compound Name | [(8S,10S,11S,13S,14S)-17-ethylsulfanyl-9-fluoro-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-11-yl] acetate |
|---|---|
| PubChem CID | 54139384 |
| Molecular Formula | C24H33FO3S2 |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [(8S,10S,11S,13S,14S)-17-ethylsulfanyl-9-fluoro-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-11-yl] acetate |
| SMILES | CCSC1(SC)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3(F)[C@@H](OC(C)=O)C[C@@]21C |
| InChI | InChI=1S/C24H33FO3S2/c1-6-30-23(29-5)12-10-18-19-8-7-16-13-17(27)9-11-21(16,3)24(19,25)20(28-15(2)26)14-22(18,23)4/h9,11,13,18-20H,6-8,10,12,14H2,1-5H3/t18-,19-,20-,21-,22-,23?,24?/m0/s1 |
| InChIKey | OAAAIXZNGAOSGB-NPODAVJLSA-N |
| XLogP | 5.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|