C27H33FO9 — CID 59223633
[2-(16,17-diacetyloxy-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate (PubChem CID 59223633) has the molecular formula C27H33FO9 and a molecular weight of 520.55 g/mol. Its IUPAC name is [2-(16,17-diacetyloxy-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate.
| Compound Name | [2-(16,17-diacetyloxy-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 59223633 |
| Molecular Formula | C27H33FO9 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [2-(16,17-diacetyloxy-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1(OC(C)=O)C(OC(C)=O)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
| InChI | InChI=1S/C27H33FO9/c1-14(29)35-13-22(34)27(37-16(3)31)23(36-15(2)30)11-20-19-7-6-17-10-18(32)8-9-24(17,4)26(19,28)21(33)12-25(20,27)5/h8-10,19-21,23,33H,6-7,11-13H2,1-5H3 |
| InChIKey | SPBQVXASJMUKDB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|