C26H32ClFO7 — CID 13325673
[(8S,9R,10S,11S,13S,14S,16R,17S)-16-acetyloxy-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 13325673) has the molecular formula C26H32ClFO7 and a molecular weight of 510.99 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,16R,17S)-16-acetyloxy-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,16R,17S)-16-acetyloxy-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 13325673 |
| Molecular Formula | C26H32ClFO7 |
| Molecular Weight | 510.99 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,16R,17S)-16-acetyloxy-17-(2-chloroacetyl)-9-fluoro-11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CCl)[C@H](OC(C)=O)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C26H32ClFO7/c1-5-22(33)35-26(20(32)13-27)21(34-14(2)29)11-18-17-7-6-15-10-16(30)8-9-23(15,3)25(17,28)19(31)12-24(18,26)4/h8-10,17-19,21,31H,5-7,11-13H2,1-4H3/t17-,18-,19-,21+,23-,24-,25-,26+/m0/s1 |
| InChIKey | ZOJOINPKOSVKFR-VHDCPBDGSA-N |
| XLogP | 3.40 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.99 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|