C28H37FO8 — CID 22841429
1-acetyloxyethyl (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 22841429) has the molecular formula C28H37FO8 and a molecular weight of 520.59 g/mol. Its IUPAC name is 1-acetyloxyethyl (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | 1-acetyloxyethyl (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 22841429 |
| Molecular Formula | C28H37FO8 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 1-acetyloxyethyl (8S,9R,10S,11S,13S,14S,16S,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCC(=O)O[C@]1(C(=O)OC(C)OC(C)=O)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C28H37FO8/c1-7-23(33)37-28(24(34)36-17(4)35-16(3)30)15(2)12-21-20-9-8-18-13-19(31)10-11-25(18,5)27(20,29)22(32)14-26(21,28)6/h10-11,13,15,17,20-22,32H,7-9,12,14H2,1-6H3/t15-,17?,20-,21-,22-,25-,26-,27-,28-/m0/s1 |
| InChIKey | OZPCGFPOTFEKAG-BPRBGFMESA-N |
| XLogP | 3.75 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|