C23H31FO4S2 — CID 88716451
[(8S,9R,10S,11S,13S,14S,17S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]sulfanylmethyl acetate (PubChem CID 88716451) has the molecular formula C23H31FO4S2 and a molecular weight of 454.63 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]sulfanylmethyl acetate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]sulfanylmethyl acetate |
|---|---|
| PubChem CID | 88716451 |
| Molecular Formula | C23H31FO4S2 |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17S)-9-fluoro-11-hydroxy-10,13-dimethyl-17-methylsulfanyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]sulfanylmethyl acetate |
| SMILES | CS[C@]1(SCOC(C)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C23H31FO4S2/c1-14(25)28-13-30-22(29-4)10-8-17-18-6-5-15-11-16(26)7-9-20(15,2)23(18,24)19(27)12-21(17,22)3/h7,9,11,17-19,27H,5-6,8,10,12-13H2,1-4H3/t17-,18-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | KZXPBRVCOIYYAZ-FQJIPJFPSA-N |
| XLogP | 4.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|