C24H34O5 — CID 68960755
[(8S,9S,10S,11S,13S,14S,16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl] 2-ethoxyacetate (PubChem CID 68960755) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(8S,9S,10S,11S,13S,14S,16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl] 2-ethoxyacetate.
| Compound Name | [(8S,9S,10S,11S,13S,14S,16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 68960755 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [(8S,9S,10S,11S,13S,14S,16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OC1=C[C@@]2(C)C(=CC1=O)CC[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C)C[C@H](C)C[C@@H]12 |
| InChI | InChI=1S/C24H34O5/c1-5-28-13-21(27)29-20-12-24(4)15(9-18(20)25)6-7-16-17-8-14(2)10-23(17,3)11-19(26)22(16)24/h9,12,14,16-17,19,22,26H,5-8,10-11,13H2,1-4H3/t14-,16+,17+,19+,22-,23+,24+/m1/s1 |
| InChIKey | BKCLPCCERDHQCZ-OFIDMZMPSA-N |
| XLogP | 3.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |