C31H48O5 — CID 50990191
decyl (8S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13,17-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-2-carboxylate (PubChem CID 50990191) has the molecular formula C31H48O5 and a molecular weight of 500.72 g/mol. Its IUPAC name is decyl (8S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13,17-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-2-carboxylate.
| Compound Name | decyl (8S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13,17-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 50990191 |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.72 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | decyl (8S,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13,17-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-2-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1=C[C@@]2(C)C(=CC1=O)CC[C@@H]1C2C(O)C[C@@]2(C)[C@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C31H48O5/c1-5-6-7-8-9-10-11-12-17-36-28(34)23-19-29(2)21(18-25(23)32)13-14-22-24-15-16-31(4,35)30(24,3)20-26(33)27(22)29/h18-19,22,24,26-27,33,35H,5-17,20H2,1-4H3/t22-,24-,26?,27?,29-,30-,31+/m0/s1 |
| InChIKey | QAXZEBWVHGLRCX-AJVMRNDSSA-N |
| XLogP | 6.07 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.72 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|