C23H40O3 — CID 139407828
(2R,3S,5S,8S,9S,10R,11S,13S,14S,17S)-11,17-dimethoxy-2,5,10,13-tetramethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 139407828) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is (2R,3S,5S,8S,9S,10R,11S,13S,14S,17S)-11,17-dimethoxy-2,5,10,13-tetramethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (2R,3S,5S,8S,9S,10R,11S,13S,14S,17S)-11,17-dimethoxy-2,5,10,13-tetramethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 139407828 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | (2R,3S,5S,8S,9S,10R,11S,13S,14S,17S)-11,17-dimethoxy-2,5,10,13-tetramethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CO[C@H]1C[C@]2(C)[C@@H](OC)CC[C@H]2[C@@H]2CC[C@@]3(C)C[C@H](O)[C@H](C)C[C@]3(C)[C@H]21 |
| InChI | InChI=1S/C23H40O3/c1-14-11-23(4)20-15(9-10-21(23,2)12-17(14)24)16-7-8-19(26-6)22(16,3)13-18(20)25-5/h14-20,24H,7-13H2,1-6H3/t14-,15+,16+,17+,18+,19+,20-,21+,22+,23-/m1/s1 |
| InChIKey | OHTGOCKSTBYSEK-GUAOBXORSA-N |
| XLogP | 4.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |