C24H32O5S — CID 87316986
(7R,8S,9S,10R,13S,14S,16R,17S)-7-(3-hydroxypropanoyloxy)-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 87316986) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is (7R,8S,9S,10R,13S,14S,16R,17S)-7-(3-hydroxypropanoyloxy)-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (7R,8S,9S,10R,13S,14S,16R,17S)-7-(3-hydroxypropanoyloxy)-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 87316986 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | (7R,8S,9S,10R,13S,14S,16R,17S)-7-(3-hydroxypropanoyloxy)-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3[C@H](OC(=O)CCO)CC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]2(C)[C@H]1C(=O)S |
| InChI | InChI=1S/C24H32O5S/c1-13-10-17-20-16(5-8-24(17,3)21(13)22(28)30)23(2)7-4-15(26)11-14(23)12-18(20)29-19(27)6-9-25/h4,7,11,13,16-18,20-21,25H,5-6,8-10,12H2,1-3H3,(H,28,30)/t13-,16+,17+,18-,20-,21-,23+,24+/m1/s1 |
| InChIKey | KMLIRGUJDDEZFP-LOEALPPOSA-N |
| XLogP | 3.52 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|