C27H31FO6S — CID 141255311
[(7R,8S,9S,10R,11S,13S,14S,16R,17S)-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl] furan-2-carboxylate (PubChem CID 141255311) has the molecular formula C27H31FO6S and a molecular weight of 502.60 g/mol. Its IUPAC name is [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl] furan-2-carboxylate.
| Compound Name | [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 141255311 |
| Molecular Formula | C27H31FO6S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-17-(fluoromethylsulfanylcarbonyl)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl] furan-2-carboxylate |
| SMILES | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@H]1C(=O)SCF)[C@@]1(C)C=CC(=O)C=C1C[C@H]3OC(=O)c1ccco1 |
| InChI | InChI=1S/C27H31FO6S/c1-14-9-17-21-20(34-24(31)19-5-4-8-33-19)11-15-10-16(29)6-7-26(15,2)23(21)18(30)12-27(17,3)22(14)25(32)35-13-28/h4-8,10,14,17-18,20-23,30H,9,11-13H2,1-3H3/t14-,17+,18+,20-,21-,22-,23+,26+,27+/m1/s1 |
| InChIKey | QNLYBEJLOIFUTJ-SWGGMSJHSA-N |
| XLogP | 4.74 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|