C26H29FO6S — CID 90983886
(8S,9R,10S,13S,14S)-9-fluoro-16-(furan-2-carbonyloxymethyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 90983886) has the molecular formula C26H29FO6S and a molecular weight of 488.58 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S)-9-fluoro-16-(furan-2-carbonyloxymethyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,9R,10S,13S,14S)-9-fluoro-16-(furan-2-carbonyloxymethyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 90983886 |
| Molecular Formula | C26H29FO6S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (8S,9R,10S,13S,14S)-9-fluoro-16-(furan-2-carbonyloxymethyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3CC(COC(=O)c4ccco4)C(C(=O)S)[C@@]3(C)CC(O)[C@@]12F |
| InChI | InChI=1S/C26H29FO6S/c1-24-12-20(29)26(27)17(6-5-15-11-16(28)7-8-25(15,26)2)18(24)10-14(21(24)23(31)34)13-33-22(30)19-4-3-9-32-19/h3-4,7-9,11,14,17-18,20-21,29H,5-6,10,12-13H2,1-2H3,(H,31,34)/t14?,17-,18-,20?,21?,24-,25-,26-/m0/s1 |
| InChIKey | GWOZBXUQNVJBTM-IJYLJBOFSA-N |
| XLogP | 4.11 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|