C28H33ClFNO5 — CID 123539108
16-[(4-chloro-N-hydroxyanilino)methyl]-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 123539108) has the molecular formula C28H33ClFNO5 and a molecular weight of 518.03 g/mol. Its IUPAC name is 16-[(4-chloro-N-hydroxyanilino)methyl]-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | 16-[(4-chloro-N-hydroxyanilino)methyl]-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123539108 |
| Molecular Formula | C28H33ClFNO5 |
| Molecular Weight | 518.03 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 16-[(4-chloro-N-hydroxyanilino)methyl]-9-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC(O)C3(F)C(CCC4=CC(=O)C=CC43C)C1CC(CN(O)c1ccc(Cl)cc1)C2C(=O)CO |
| InChI | InChI=1S/C28H33ClFNO5/c1-26-13-24(35)28(30)21(8-3-17-12-20(33)9-10-27(17,28)2)22(26)11-16(25(26)23(34)15-32)14-31(36)19-6-4-18(29)5-7-19/h4-7,9-10,12,16,21-22,24-25,32,35-36H,3,8,11,13-15H2,1-2H3 |
| InChIKey | KYQRUTKLRDPFGM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.03 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|