C30H34ClF2NO6S — CID 123404954
[2-[16-[(4-chloro-N-hydroxyanilino)methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methylsulfanylformate (PubChem CID 123404954) has the molecular formula C30H34ClF2NO6S and a molecular weight of 610.12 g/mol. Its IUPAC name is [2-[16-[(4-chloro-N-hydroxyanilino)methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methylsulfanylformate.
| Compound Name | [2-[16-[(4-chloro-N-hydroxyanilino)methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methylsulfanylformate |
|---|---|
| PubChem CID | 123404954 |
| Molecular Formula | C30H34ClF2NO6S |
| Molecular Weight | 610.12 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | [2-[16-[(4-chloro-N-hydroxyanilino)methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methylsulfanylformate |
| SMILES | CSC(=O)OCC(=O)C1C(CN(O)c2ccc(Cl)cc2)CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
| InChI | InChI=1S/C30H34ClF2NO6S/c1-28-13-25(37)30(33)21(12-23(32)22-11-19(35)8-9-29(22,30)2)20(28)10-16(26(28)24(36)15-40-27(38)41-3)14-34(39)18-6-4-17(31)5-7-18/h4-9,11,16,20-21,23,25-26,37,39H,10,12-15H2,1-3H3 |
| InChIKey | DMTYAYLYQUCYMB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.12 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|