C30H34ClF2NO6 — CID 123889484
[2-[16-[(4-chloro-N-hydroxyanilino)methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 123889484) has the molecular formula C30H34ClF2NO6 and a molecular weight of 578.05 g/mol. Its IUPAC name is [2-[16-[(4-chloro-N-hydroxyanilino)methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[16-[(4-chloro-N-hydroxyanilino)methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 123889484 |
| Molecular Formula | C30H34ClF2NO6 |
| Molecular Weight | 578.05 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | [2-[16-[(4-chloro-N-hydroxyanilino)methyl]-6,9-difluoro-11-hydroxy-10,13-dimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)C1C(CN(O)c2ccc(Cl)cc2)CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
| InChI | InChI=1S/C30H34ClF2NO6/c1-16(35)40-15-25(37)27-17(14-34(39)19-6-4-18(31)5-7-19)10-21-22-12-24(32)23-11-20(36)8-9-29(23,3)30(22,33)26(38)13-28(21,27)2/h4-9,11,17,21-22,24,26-27,38-39H,10,12-15H2,1-3H3 |
| InChIKey | WSAVOSIGBIRRJV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.05 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|