C27H37ClO5 — CID 70616352
[2-[(8S,9S,10R,13S,14S,17S)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2-dimethylpropanoate (PubChem CID 70616352) has the molecular formula C27H37ClO5 and a molecular weight of 477.04 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17S)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17S)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 70616352 |
| Molecular Formula | C27H37ClO5 |
| Molecular Weight | 477.04 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2-dimethylpropanoate |
| SMILES | CC1C[C@H]2[C@@H]3C(Cl)CC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@]2(C)[C@H]1C(=O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H37ClO5/c1-14-9-17-21-18(28)11-15-10-16(29)7-8-26(15,5)23(21)19(30)12-27(17,6)22(14)20(31)13-33-24(32)25(2,3)4/h7-8,10,14,17-19,21-23,30H,9,11-13H2,1-6H3/t14?,17-,18?,19?,21+,22+,23-,26-,27-/m0/s1 |
| InChIKey | POQVSTFIPMETMB-IJXSHHEQSA-N |
| XLogP | 4.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.04 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|