C26H30O6S — CID 140681037
(8S,9S,10R,11S,13R,14S,16R,17S)-13-(furan-2-carbonyloxymethyl)-11-hydroxy-10,16-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 140681037) has the molecular formula C26H30O6S and a molecular weight of 470.59 g/mol. Its IUPAC name is (8S,9S,10R,11S,13R,14S,16R,17S)-13-(furan-2-carbonyloxymethyl)-11-hydroxy-10,16-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (8S,9S,10R,11S,13R,14S,16R,17S)-13-(furan-2-carbonyloxymethyl)-11-hydroxy-10,16-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 140681037 |
| Molecular Formula | C26H30O6S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (8S,9S,10R,11S,13R,14S,16R,17S)-13-(furan-2-carbonyloxymethyl)-11-hydroxy-10,16-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@]2(COC(=O)c2ccco2)[C@H]1C(=O)S |
| InChI | InChI=1S/C26H30O6S/c1-14-10-18-17-6-5-15-11-16(27)7-8-25(15,2)22(17)19(28)12-26(18,21(14)24(30)33)13-32-23(29)20-4-3-9-31-20/h3-4,7-9,11,14,17-19,21-22,28H,5-6,10,12-13H2,1-2H3,(H,30,33)/t14-,17+,18+,19+,21-,22-,25+,26-/m1/s1 |
| InChIKey | IBNKTCMLCGEHMR-XGIUUMOFSA-N |
| XLogP | 4.01 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|