C36H37NO6S — CID 58362904
[(11S,16R,17R)-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate (PubChem CID 58362904) has the molecular formula C36H37NO6S and a molecular weight of 611.76 g/mol. Its IUPAC name is [(11S,16R,17R)-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate.
| Compound Name | [(11S,16R,17R)-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 58362904 |
| Molecular Formula | C36H37NO6S |
| Molecular Weight | 611.76 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | [(11S,16R,17R)-11-hydroxy-10,13,16-trimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)[C@@]1(OC(=O)c1ccco1)C(=O)CSc1ccc2ccccc2n1 |
| InChI | InChI=1S/C36H37NO6S/c1-21-17-26-25-12-11-23-18-24(38)14-15-34(23,2)32(25)28(39)19-35(26,3)36(21,43-33(41)29-9-6-16-42-29)30(40)20-44-31-13-10-22-7-4-5-8-27(22)37-31/h4-10,13-16,18,21,25-26,28,32,39H,11-12,17,19-20H2,1-3H3/t21-,25?,26?,28?,32?,34?,35?,36+/m1/s1 |
| InChIKey | CDGAIDCTRSCURU-QCRJUXHCSA-N |
| XLogP | 6.61 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.76 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |