C35H35NO6S — CID 58362851
[(11S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate (PubChem CID 58362851) has the molecular formula C35H35NO6S and a molecular weight of 597.73 g/mol. Its IUPAC name is [(11S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate.
| Compound Name | [(11S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 58362851 |
| Molecular Formula | C35H35NO6S |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | [(11S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(OC(=O)c1ccco1)C(=O)CSc1ccc2ccccc2n1 |
| InChI | InChI=1S/C35H35NO6S/c1-33-15-13-23(37)18-22(33)10-11-24-25-14-16-35(34(25,2)19-27(38)31(24)33,42-32(40)28-8-5-17-41-28)29(39)20-43-30-12-9-21-6-3-4-7-26(21)36-30/h3-9,12-13,15,17-18,24-25,27,31,38H,10-11,14,16,19-20H2,1-2H3/t24?,25?,27?,31?,33?,34?,35-/m0/s1 |
| InChIKey | UCBPKTZTMFHNOG-CPQPHIBHSA-N |
| XLogP | 6.36 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |