C27H33NO4S — CID 160793894
(17R)-11,17-dihydroxy-10,13-dimethyl-17-[2-[(6-methyl-2-pyridinyl)sulfanyl]acetyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 160793894) has the molecular formula C27H33NO4S and a molecular weight of 467.63 g/mol. Its IUPAC name is (17R)-11,17-dihydroxy-10,13-dimethyl-17-[2-[(6-methyl-2-pyridinyl)sulfanyl]acetyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (17R)-11,17-dihydroxy-10,13-dimethyl-17-[2-[(6-methyl-2-pyridinyl)sulfanyl]acetyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 160793894 |
| Molecular Formula | C27H33NO4S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (17R)-11,17-dihydroxy-10,13-dimethyl-17-[2-[(6-methyl-2-pyridinyl)sulfanyl]acetyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | Cc1cccc(SCC(=O)[C@@]2(O)CCC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC32C)n1 |
| InChI | InChI=1S/C27H33NO4S/c1-16-5-4-6-23(28-16)33-15-22(31)27(32)12-10-20-19-8-7-17-13-18(29)9-11-25(17,2)24(19)21(30)14-26(20,27)3/h4-6,9,11,13,19-21,24,30,32H,7-8,10,12,14-15H2,1-3H3/t19?,20?,21?,24?,25?,26?,27-/m0/s1 |
| InChIKey | DWROLAONJISKBC-FULDRHPDSA-N |
| XLogP | 4.06 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |