C34H39NO5S — CID 159590141
(4R,6R,8S,11S)-11-ethoxy-6,9,13-trimethyl-8-(2-quinolin-2-ylsulfanylacetyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 159590141) has the molecular formula C34H39NO5S and a molecular weight of 573.76 g/mol. Its IUPAC name is (4R,6R,8S,11S)-11-ethoxy-6,9,13-trimethyl-8-(2-quinolin-2-ylsulfanylacetyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (4R,6R,8S,11S)-11-ethoxy-6,9,13-trimethyl-8-(2-quinolin-2-ylsulfanylacetyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 159590141 |
| Molecular Formula | C34H39NO5S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | (4R,6R,8S,11S)-11-ethoxy-6,9,13-trimethyl-8-(2-quinolin-2-ylsulfanylacetyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CCOC1CC2(C)C(C[C@H]3O[C@@H](C)O[C@]32C(=O)CSc2ccc3ccccc3n2)C2CCC3=CC(=O)C=CC3(C)C12 |
| InChI | InChI=1S/C34H39NO5S/c1-5-38-27-18-33(4)25(24-12-11-22-16-23(36)14-15-32(22,3)31(24)27)17-29-34(33,40-20(2)39-29)28(37)19-41-30-13-10-21-8-6-7-9-26(21)35-30/h6-10,13-16,20,24-25,27,29,31H,5,11-12,17-19H2,1-4H3/t20-,24?,25?,27?,29-,31?,32?,33?,34-/m1/s1 |
| InChIKey | MKDBWKOWMJAFAP-BNSRSADJSA-N |
| XLogP | 6.33 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |