C35H40O6 — CID 158743067
(4R,8S)-11-hydroxy-9,13-dimethyl-8-(2-naphthalen-1-yloxyacetyl)-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 158743067) has the molecular formula C35H40O6 and a molecular weight of 556.70 g/mol. Its IUPAC name is (4R,8S)-11-hydroxy-9,13-dimethyl-8-(2-naphthalen-1-yloxyacetyl)-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (4R,8S)-11-hydroxy-9,13-dimethyl-8-(2-naphthalen-1-yloxyacetyl)-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 158743067 |
| Molecular Formula | C35H40O6 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | (4R,8S)-11-hydroxy-9,13-dimethyl-8-(2-naphthalen-1-yloxyacetyl)-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CCCC1O[C@@H]2CC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC3(C)[C@]2(C(=O)COc2cccc3ccccc23)O1 |
| InChI | InChI=1S/C35H40O6/c1-4-8-31-40-30-18-26-25-14-13-22-17-23(36)15-16-33(22,2)32(25)27(37)19-34(26,3)35(30,41-31)29(38)20-39-28-12-7-10-21-9-5-6-11-24(21)28/h5-7,9-12,15-17,25-27,30-32,37H,4,8,13-14,18-20H2,1-3H3/t25?,26?,27?,30-,31?,32?,33?,34?,35-/m1/s1 |
| InChIKey | WQYZCAKAYLXYQY-UYJQKQNMSA-N |
| XLogP | 5.96 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |