C34H43NO7 — CID 134507154
N-[4-[2-[(6R)-11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoethoxy]phenyl]propanamide (PubChem CID 134507154) has the molecular formula C34H43NO7 and a molecular weight of 577.72 g/mol. Its IUPAC name is N-[4-[2-[(6R)-11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoethoxy]phenyl]propanamide.
| Compound Name | N-[4-[2-[(6R)-11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoethoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 134507154 |
| Molecular Formula | C34H43NO7 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | N-[4-[2-[(6R)-11-hydroxy-9,13-dimethyl-16-oxo-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoethoxy]phenyl]propanamide |
| SMILES | CCC[C@@H]1OC2CC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC3(C)C2(C(=O)COc2ccc(NC(=O)CC)cc2)O1 |
| InChI | InChI=1S/C34H43NO7/c1-5-7-30-41-28-17-25-24-13-8-20-16-22(36)14-15-32(20,3)31(24)26(37)18-33(25,4)34(28,42-30)27(38)19-40-23-11-9-21(10-12-23)35-29(39)6-2/h9-12,14-16,24-26,28,30-31,37H,5-8,13,17-19H2,1-4H3,(H,35,39)/t24?,25?,26?,28?,30-,31?,32?,33?,34?/m1/s1 |
| InChIKey | OVKLBJVIIYGGCW-NYCFJUCJSA-N |
| XLogP | 5.15 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |