C34H39NO5S — CID 158102366
(4R,6R,8S)-11-hydroxy-8-(2-isoquinolin-1-ylsulfanylacetyl)-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 158102366) has the molecular formula C34H39NO5S and a molecular weight of 573.76 g/mol. Its IUPAC name is (4R,6R,8S)-11-hydroxy-8-(2-isoquinolin-1-ylsulfanylacetyl)-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (4R,6R,8S)-11-hydroxy-8-(2-isoquinolin-1-ylsulfanylacetyl)-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 158102366 |
| Molecular Formula | C34H39NO5S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | (4R,6R,8S)-11-hydroxy-8-(2-isoquinolin-1-ylsulfanylacetyl)-9,13-dimethyl-6-propyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CCC[C@@H]1O[C@@H]2CC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC3(C)[C@]2(C(=O)CSc2nccc3ccccc23)O1 |
| InChI | InChI=1S/C34H39NO5S/c1-4-7-29-39-28-17-25-24-11-10-21-16-22(36)12-14-32(21,2)30(24)26(37)18-33(25,3)34(28,40-29)27(38)19-41-31-23-9-6-5-8-20(23)13-15-35-31/h5-6,8-9,12-16,24-26,28-30,37H,4,7,10-11,17-19H2,1-3H3/t24?,25?,26?,28-,29-,30?,32?,33?,34-/m1/s1 |
| InChIKey | YUVBTOYKTFXRHL-XMGNJLAKSA-N |
| XLogP | 6.07 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |