C31H35Cl3O5S — CID 160598186
(4R,6R,8S)-11-hydroxy-9,13-dimethyl-6-propyl-8-[2-(2,4,5-trichlorophenyl)sulfanylacetyl]-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 160598186) has the molecular formula C31H35Cl3O5S and a molecular weight of 626.04 g/mol. Its IUPAC name is (4R,6R,8S)-11-hydroxy-9,13-dimethyl-6-propyl-8-[2-(2,4,5-trichlorophenyl)sulfanylacetyl]-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (4R,6R,8S)-11-hydroxy-9,13-dimethyl-6-propyl-8-[2-(2,4,5-trichlorophenyl)sulfanylacetyl]-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 160598186 |
| Molecular Formula | C31H35Cl3O5S |
| Molecular Weight | 626.04 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | (4R,6R,8S)-11-hydroxy-9,13-dimethyl-6-propyl-8-[2-(2,4,5-trichlorophenyl)sulfanylacetyl]-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CCC[C@@H]1O[C@@H]2CC3C4CCC5=CC(=O)C=CC5(C)C4C(O)CC3(C)[C@]2(C(=O)CSc2cc(Cl)c(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C31H35Cl3O5S/c1-4-5-27-38-26-11-19-18-7-6-16-10-17(35)8-9-29(16,2)28(18)23(36)14-30(19,3)31(26,39-27)25(37)15-40-24-13-21(33)20(32)12-22(24)34/h8-10,12-13,18-19,23,26-28,36H,4-7,11,14-15H2,1-3H3/t18?,19?,23?,26-,27-,28?,29?,30?,31-/m1/s1 |
| InChIKey | MMKXIJYLHDOSED-LSFBMEDOSA-N |
| XLogP | 7.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.04 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|