C37H38FNO5S — CID 58362940
[(11S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-fluorobenzoate (PubChem CID 58362940) has the molecular formula C37H38FNO5S and a molecular weight of 627.78 g/mol. Its IUPAC name is [(11S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-fluorobenzoate.
| Compound Name | [(11S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 58362940 |
| Molecular Formula | C37H38FNO5S |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | [(11S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(2-quinolin-2-ylsulfanylacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-fluorobenzoate |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(OC(=O)c1ccccc1F)C(=O)CSc1ccc2ccccc2n1 |
| InChI | InChI=1S/C37H38FNO5S/c1-35-17-15-24(40)19-23(35)12-13-25-27-16-18-37(36(27,2)20-30(41)33(25)35,44-34(43)26-8-4-5-9-28(26)38)31(42)21-45-32-14-11-22-7-3-6-10-29(22)39-32/h3-11,14,19,25,27,30,33,41H,12-13,15-18,20-21H2,1-2H3/t25?,27?,30?,33?,35?,36?,37-/m0/s1 |
| InChIKey | IVPCHLUNAYAWAB-UWDPTJCBSA-N |
| XLogP | 7.13 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |