C22H33BrO2 — CID 18594171
(6S,7R,8R,9R,10S,13R,14S,16R,17R)-9-bromo-17-ethyl-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6,7-diol (PubChem CID 18594171) has the molecular formula C22H33BrO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is (6S,7R,8R,9R,10S,13R,14S,16R,17R)-9-bromo-17-ethyl-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6,7-diol.
| Compound Name | (6S,7R,8R,9R,10S,13R,14S,16R,17R)-9-bromo-17-ethyl-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6,7-diol |
|---|---|
| PubChem CID | 18594171 |
| Molecular Formula | C22H33BrO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (6S,7R,8R,9R,10S,13R,14S,16R,17R)-9-bromo-17-ethyl-10,13,16-trimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-6,7-diol |
| SMILES | CC[C@@H]1[C@H](C)C[C@H]2[C@@H]3[C@@H](O)[C@@H](O)C4=CCC=C[C@]4(C)[C@@]3(Br)CC[C@]12C |
| InChI | InChI=1S/C22H33BrO2/c1-5-14-13(2)12-16-17-19(25)18(24)15-8-6-7-9-21(15,4)22(17,23)11-10-20(14,16)3/h7-9,13-14,16-19,24-25H,5-6,10-12H2,1-4H3/t13-,14-,16+,17-,18+,19-,20-,21+,22-/m1/s1 |
| InChIKey | BQUBIKOILPIQDY-ALJUCOSSSA-N |
| XLogP | 4.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|