C20H26Cl2O2 — CID 3465914
9,11-dichloro-17-hydroxy-10,13,17-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 3465914) has the molecular formula C20H26Cl2O2 and a molecular weight of 369.33 g/mol. Its IUPAC name is 9,11-dichloro-17-hydroxy-10,13,17-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 9,11-dichloro-17-hydroxy-10,13,17-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 3465914 |
| Molecular Formula | C20H26Cl2O2 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 9,11-dichloro-17-hydroxy-10,13,17-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1(O)CCC2C3CCC4=CC(=O)C=CC4(C)C3(Cl)C(Cl)CC21C |
| InChI | InChI=1S/C20H26Cl2O2/c1-17-8-6-13(23)10-12(17)4-5-15-14-7-9-19(3,24)18(14,2)11-16(21)20(15,17)22/h6,8,10,14-16,24H,4-5,7,9,11H2,1-3H3 |
| InChIKey | DTRQCQCIZWZEJK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|