C21H25ClO6 — CID 22788398
2-[(8S,9R,10S,11S,13S,14S,17R)-9-chloro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetic acid (PubChem CID 22788398) has the molecular formula C21H25ClO6 and a molecular weight of 408.88 g/mol. Its IUPAC name is 2-[(8S,9R,10S,11S,13S,14S,17R)-9-chloro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetic acid.
| Compound Name | 2-[(8S,9R,10S,11S,13S,14S,17R)-9-chloro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 22788398 |
| Molecular Formula | C21H25ClO6 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[(8S,9R,10S,11S,13S,14S,17R)-9-chloro-11,17-dihydroxy-10,13-dimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoacetic acid |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1[C@@H]3CC[C@](O)(C(=O)C(=O)O)[C@@]3(C)C[C@H](O)[C@@]12Cl |
| InChI | InChI=1S/C21H25ClO6/c1-18-7-5-12(23)9-11(18)3-4-14-13-6-8-20(28,16(25)17(26)27)19(13,2)10-15(24)21(14,18)22/h5,7,9,13-15,24,28H,3-4,6,8,10H2,1-2H3,(H,26,27)/t13-,14-,15-,18-,19-,20-,21-/m0/s1 |
| InChIKey | PKVGVXDZIHGCIA-RXKCZQJNSA-N |
| XLogP | 2.01 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|