C27H30Cl2O5 — CID 70501426
[(8S,9R,10S,13S,14S,17R)-17-acetyl-9,11-dichloro-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate (PubChem CID 70501426) has the molecular formula C27H30Cl2O5 and a molecular weight of 505.44 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,17R)-17-acetyl-9,11-dichloro-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate.
| Compound Name | [(8S,9R,10S,13S,14S,17R)-17-acetyl-9,11-dichloro-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 70501426 |
| Molecular Formula | C27H30Cl2O5 |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [(8S,9R,10S,13S,14S,17R)-17-acetyl-9,11-dichloro-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
| SMILES | CC(=O)[C@@]1(OC(=O)c2ccco2)C(C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(Cl)C[C@@]21C |
| InChI | InChI=1S/C27H30Cl2O5/c1-15-12-20-19-8-7-17-13-18(31)9-10-24(17,3)26(19,29)22(28)14-25(20,4)27(15,16(2)30)34-23(32)21-6-5-11-33-21/h5-6,9-11,13,15,19-20,22H,7-8,12,14H2,1-4H3/t15?,19-,20-,22?,24-,25-,26-,27-/m0/s1 |
| InChIKey | DPSZADBSLMJZMC-BLVBMUQOSA-N |
| XLogP | 5.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|