C27H30Cl2O6 — CID 25255530
[(9R,10S,11S,13S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-deuteriooxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate (PubChem CID 25255530) has the molecular formula C27H30Cl2O6 and a molecular weight of 522.44 g/mol. Its IUPAC name is [(9R,10S,11S,13S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-deuteriooxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate.
| Compound Name | [(9R,10S,11S,13S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-deuteriooxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 25255530 |
| Molecular Formula | C27H30Cl2O6 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | [(9R,10S,11S,13S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-deuteriooxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
| SMILES | [2H]O[C@H]1C[C@@]2(C)C(C[C@@H](C)[C@]2(OC(=O)c2ccco2)C(=O)CCl)C2CCC3=CC(=O)C=C[C@]3(C)[C@]21Cl |
| InChI | InChI=1S/C27H30Cl2O6/c1-15-11-19-18-7-6-16-12-17(30)8-9-24(16,2)26(18,29)21(31)13-25(19,3)27(15,22(32)14-28)35-23(33)20-5-4-10-34-20/h4-5,8-10,12,15,18-19,21,31H,6-7,11,13-14H2,1-3H3/t15-,18?,19?,21+,24+,25+,26+,27+/m1/s1/i31D |
| InChIKey | WOFMFGQZHJDGCX-FUKDYKLRSA-N |
| XLogP | 4.87 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|