C31H39ClO6S — CID 143531906
[(9R,11S,13S,16R,17R)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-pentylsulfanylcarbonyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate (PubChem CID 143531906) has the molecular formula C31H39ClO6S and a molecular weight of 575.17 g/mol. Its IUPAC name is [(9R,11S,13S,16R,17R)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-pentylsulfanylcarbonyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate.
| Compound Name | [(9R,11S,13S,16R,17R)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-pentylsulfanylcarbonyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 143531906 |
| Molecular Formula | C31H39ClO6S |
| Molecular Weight | 575.17 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | [(9R,11S,13S,16R,17R)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-pentylsulfanylcarbonyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] furan-2-carboxylate |
| SMILES | CCCCCSC(=O)[C@@]1(OC(=O)c2ccco2)[C@H](C)CC2C3CCC4=CC(=O)C=CC4(C)[C@@]3(Cl)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C31H39ClO6S/c1-5-6-7-15-39-27(36)31(38-26(35)24-9-8-14-37-24)19(2)16-23-22-11-10-20-17-21(33)12-13-28(20,3)30(22,32)25(34)18-29(23,31)4/h8-9,12-14,17,19,22-23,25,34H,5-7,10-11,15-16,18H2,1-4H3/t19-,22?,23?,25+,28?,29+,30+,31+/m1/s1 |
| InChIKey | IFSDHNBNYCYTKO-FUAZVBQOSA-N |
| XLogP | 6.51 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.17 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|