C21H26Cl2O3 — CID 57222716
(8S,9R,10R,13S,14S,17S)-17-acetyl-9,11-dichloro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-1,3-dione (PubChem CID 57222716) has the molecular formula C21H26Cl2O3 and a molecular weight of 397.34 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S,17S)-17-acetyl-9,11-dichloro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-1,3-dione.
| Compound Name | (8S,9R,10R,13S,14S,17S)-17-acetyl-9,11-dichloro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-1,3-dione |
|---|---|
| PubChem CID | 57222716 |
| Molecular Formula | C21H26Cl2O3 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (8S,9R,10R,13S,14S,17S)-17-acetyl-9,11-dichloro-10,13-dimethyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-1,3-dione |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC(=O)[C@]4(C)[C@@]3(Cl)C(Cl)C[C@]12C |
| InChI | InChI=1S/C21H26Cl2O3/c1-11(24)14-6-7-15-16-5-4-12-8-13(25)9-18(26)20(12,3)21(16,23)17(22)10-19(14,15)2/h8,14-17H,4-7,9-10H2,1-3H3/t14-,15+,16+,17?,19-,20-,21+/m1/s1 |
| InChIKey | IXHHJHLMUROKCU-CAIQDGIMSA-N |
| XLogP | 4.48 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|