C24H34O2S — CID 57264674
2-sulfanylethyl (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthrene-6-carboxylate (PubChem CID 57264674) has the molecular formula C24H34O2S and a molecular weight of 386.60 g/mol. Its IUPAC name is 2-sulfanylethyl (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthrene-6-carboxylate.
| Compound Name | 2-sulfanylethyl (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthrene-6-carboxylate |
|---|---|
| PubChem CID | 57264674 |
| Molecular Formula | C24H34O2S |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-sulfanylethyl (8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-8,9,11,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthrene-6-carboxylate |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3C=C(C(=O)OCCS)C4=CCC=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H34O2S/c1-4-16-8-9-20-17-15-18(22(25)26-13-14-27)19-7-5-6-11-24(19,3)21(17)10-12-23(16,20)2/h6-7,11,15-17,20-21,27H,4-5,8-10,12-14H2,1-3H3/t16-,17-,20-,21-,23+,24-/m0/s1 |
| InChIKey | OAHWDZSDHZPBGL-YUCPFZPOSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|