C21H29ClO — CID 154122721
2-chloro-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 154122721) has the molecular formula C21H29ClO and a molecular weight of 332.92 g/mol. Its IUPAC name is 2-chloro-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-chloro-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 154122721 |
| Molecular Formula | C21H29ClO |
| Molecular Weight | 332.92 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2-chloro-1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C[C@]12CC[C@H]3[C@@H](C=CC4=CCCC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)CCl |
| InChI | InChI=1S/C21H29ClO/c1-20-11-4-3-5-14(20)6-7-15-16-8-9-18(19(23)13-22)21(16,2)12-10-17(15)20/h5-7,15-18H,3-4,8-13H2,1-2H3/t15-,16-,17-,18+,20-,21-/m0/s1 |
| InChIKey | BZJZVNPNSRKLGQ-YFWFAHHUSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.92 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|