C25H35NO4 — CID 174308972
(8S,9S,10S,13S,14S,17S)-1-(diethylcarbamoyl)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 174308972) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S,17S)-1-(diethylcarbamoyl)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (8S,9S,10S,13S,14S,17S)-1-(diethylcarbamoyl)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 174308972 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (8S,9S,10S,13S,14S,17S)-1-(diethylcarbamoyl)-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CCN(CC)C(=O)C1CC(=O)C=C2C=C[C@H]3[C@@H]4CC[C@H](C(=O)O)[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C25H35NO4/c1-5-26(6-2)22(28)21-14-16(27)13-15-7-8-17-18-9-10-20(23(29)30)24(18,3)12-11-19(17)25(15,21)4/h7-8,13,17-21H,5-6,9-12,14H2,1-4H3,(H,29,30)/t17-,18-,19-,20+,21?,24-,25-/m0/s1 |
| InChIKey | NZIMGRDZDLEQRA-WNHFNZPDSA-N |
| XLogP | 4.09 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |