C23H30O4 — CID 174929254
2-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl]acetic acid (PubChem CID 174929254) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl]acetic acid.
| Compound Name | 2-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl]acetic acid |
|---|---|
| PubChem CID | 174929254 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-1-yl]acetic acid |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(=O)CC(CC(=O)O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H30O4/c1-13(24)18-6-7-19-17-5-4-14-10-16(25)11-15(12-21(26)27)23(14,3)20(17)8-9-22(18,19)2/h4-5,10,15,17-20H,6-9,11-12H2,1-3H3,(H,26,27)/t15?,17-,18+,19-,20-,22+,23+/m0/s1 |
| InChIKey | KUHUFSYPLXKORK-AYZDVHEOSA-N |
| XLogP | 4.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |