C29H40O4 — CID 70541213
[(6R)-6-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxoheptan-2-yl] acetate (PubChem CID 70541213) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is [(6R)-6-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxoheptan-2-yl] acetate.
| Compound Name | [(6R)-6-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxoheptan-2-yl] acetate |
|---|---|
| PubChem CID | 70541213 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | [(6R)-6-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-3-oxoheptan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H40O4/c1-18(7-12-26(32)27(3,4)33-19(2)30)23-10-11-24-22-9-8-20-17-21(31)13-15-28(20,5)25(22)14-16-29(23,24)6/h8-9,13,15,17-18,22-25H,7,10-12,14,16H2,1-6H3/t18-,22+,23-,24+,25+,28+,29-/m1/s1 |
| InChIKey | ZVWRWXBTFDWMCB-PVEWPBSTSA-N |
| XLogP | 6.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |