C26H40O2 — CID 145476874
(8S,9R,10S,13R,14S,17R)-17-(5-hydroxypentan-2-yl)-1,2,10,13-tetramethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 145476874) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S,17R)-17-(5-hydroxypentan-2-yl)-1,2,10,13-tetramethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13R,14S,17R)-17-(5-hydroxypentan-2-yl)-1,2,10,13-tetramethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 145476874 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | (8S,9R,10S,13R,14S,17R)-17-(5-hydroxypentan-2-yl)-1,2,10,13-tetramethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1C(=O)C=C2C=C[C@@H]3[C@@H](CC[C@]4(C)[C@@H](C(C)CCCO)CC[C@@H]34)[C@]2(C)C1C |
| InChI | InChI=1S/C26H40O2/c1-16(7-6-14-27)21-10-11-22-20-9-8-19-15-24(28)17(2)18(3)26(19,5)23(20)12-13-25(21,22)4/h8-9,15-18,20-23,27H,6-7,10-14H2,1-5H3/t16?,17?,18?,20-,21+,22-,23+,25+,26+/m0/s1 |
| InChIKey | BOSMRXQVUJYVMA-DRBBHHIQSA-N |
| XLogP | 5.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |