C21H28O3 — CID 86738157
(1S,2R,3R,5R,11S,12S,15S,16S)-15-[(1R)-1-hydroxyethyl]-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one (PubChem CID 86738157) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1S,2R,3R,5R,11S,12S,15S,16S)-15-[(1R)-1-hydroxyethyl]-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one.
| Compound Name | (1S,2R,3R,5R,11S,12S,15S,16S)-15-[(1R)-1-hydroxyethyl]-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one |
|---|---|
| PubChem CID | 86738157 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1S,2R,3R,5R,11S,12S,15S,16S)-15-[(1R)-1-hydroxyethyl]-2,16-dimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-dien-6-one |
| SMILES | C[C@@H](O)[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(=O)[C@@H]5O[C@@H]5[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H28O3/c1-11(22)14-6-7-15-13-5-4-12-10-17(23)18-19(24-18)21(12,3)16(13)8-9-20(14,15)2/h4-5,10-11,13-16,18-19,22H,6-9H2,1-3H3/t11-,13+,14-,15+,16+,18+,19+,20-,21+/m1/s1 |
| InChIKey | UCOVXACYVTUFJX-PPLRNYJISA-N |
| XLogP | 3.28 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|