C23H30O4 — CID 139715126
(1'S,2R,2'R,3'R,5'R,11'R,12'S,16'S)-2',3,16'-trimethylspiro[1,4-dioxane-2,15'-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-diene]-6'-one (PubChem CID 139715126) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (1'S,2R,2'R,3'R,5'R,11'R,12'S,16'S)-2',3,16'-trimethylspiro[1,4-dioxane-2,15'-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-diene]-6'-one.
| Compound Name | (1'S,2R,2'R,3'R,5'R,11'R,12'S,16'S)-2',3,16'-trimethylspiro[1,4-dioxane-2,15'-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-diene]-6'-one |
|---|---|
| PubChem CID | 139715126 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (1'S,2R,2'R,3'R,5'R,11'R,12'S,16'S)-2',3,16'-trimethylspiro[1,4-dioxane-2,15'-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-7,9-diene]-6'-one |
| SMILES | CC1OCCO[C@@]12CC[C@H]1[C@@H]3C=CC4=CC(=O)[C@@H]5O[C@@H]5[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C23H30O4/c1-13-23(26-11-10-25-13)9-7-16-15-5-4-14-12-18(24)19-20(27-19)22(14,3)17(15)6-8-21(16,23)2/h4-5,12-13,15-17,19-20H,6-11H2,1-3H3/t13?,15-,16-,17-,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | WMKBFHAOQHZDCJ-NAEYKSNYSA-N |
| XLogP | 3.46 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|