C26H44O3Si — CID 154412827
trimethyl-[(5S,8R,9S,10R,13S,14S,17R)-3',10,13-trimethylspiro[1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,4-dioxane]-3-yl]oxysilane (PubChem CID 154412827) has the molecular formula C26H44O3Si and a molecular weight of 432.72 g/mol. Its IUPAC name is trimethyl-[(5S,8R,9S,10R,13S,14S,17R)-3',10,13-trimethylspiro[1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,4-dioxane]-3-yl]oxysilane.
| Compound Name | trimethyl-[(5S,8R,9S,10R,13S,14S,17R)-3',10,13-trimethylspiro[1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,4-dioxane]-3-yl]oxysilane |
|---|---|
| PubChem CID | 154412827 |
| Molecular Formula | C26H44O3Si |
| Molecular Weight | 432.72 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | trimethyl-[(5S,8R,9S,10R,13S,14S,17R)-3',10,13-trimethylspiro[1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,4-dioxane]-3-yl]oxysilane |
| SMILES | CC1OCCO[C@@]12CC[C@H]1[C@@H]3CC[C@H]4C=C(O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C26H44O3Si/c1-18-26(28-16-15-27-18)14-11-23-21-8-7-19-17-20(29-30(4,5)6)9-12-24(19,2)22(21)10-13-25(23,26)3/h17-19,21-23H,7-16H2,1-6H3/t18?,19-,21+,22-,23-,24-,25-,26-/m0/s1 |
| InChIKey | AWVNXJYMSCPZPE-ILIGICCYSA-N |
| XLogP | 6.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.72 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|