C27H44O4Si — CID 588439
(17-acetyl-6,10,13-trimethyl-3-trimethylsilyloxy-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl) acetate (PubChem CID 588439) has the molecular formula C27H44O4Si and a molecular weight of 460.73 g/mol. Its IUPAC name is (17-acetyl-6,10,13-trimethyl-3-trimethylsilyloxy-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl) acetate.
| Compound Name | (17-acetyl-6,10,13-trimethyl-3-trimethylsilyloxy-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl) acetate |
|---|---|
| PubChem CID | 588439 |
| Molecular Formula | C27H44O4Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (17-acetyl-6,10,13-trimethyl-3-trimethylsilyloxy-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl) acetate |
| SMILES | CC(=O)OC1(C(C)=O)CCC2C3CC(C)C4C=C(O[Si](C)(C)C)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C27H44O4Si/c1-17-15-21-22(25(4)12-9-20(16-24(17)25)31-32(6,7)8)10-13-26(5)23(21)11-14-27(26,18(2)28)30-19(3)29/h16-17,21-24H,9-15H2,1-8H3 |
| InChIKey | UMPLUGIALJGMDA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|