C21H34N2O — CID 66708297
(8R,9R,10R,13S,14S)-10,13-dimethyl-7,17-bis(methylamino)-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol (PubChem CID 66708297) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-7,17-bis(methylamino)-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-7,17-bis(methylamino)-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 66708297 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-7,17-bis(methylamino)-4,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CNC1C=C2CC(O)C=C[C@]2(C)[C@@H]2CC[C@]3(C)C(NC)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C21H34N2O/c1-20-9-7-14(24)11-13(20)12-17(22-3)19-15-5-6-18(23-4)21(15,2)10-8-16(19)20/h7,9,12,14-19,22-24H,5-6,8,10-11H2,1-4H3/t14?,15-,16+,17?,18?,19-,20-,21-/m0/s1 |
| InChIKey | SEMJJNJNYXICMH-GDEOLATOSA-N |
| XLogP | 2.87 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|