C20H30FNO — CID 68997048
(8R,9R,10R,13S,14S)-16-fluoro-10,13-dimethyl-17-(methylamino)-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol (PubChem CID 68997048) has the molecular formula C20H30FNO and a molecular weight of 319.46 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-16-fluoro-10,13-dimethyl-17-(methylamino)-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9R,10R,13S,14S)-16-fluoro-10,13-dimethyl-17-(methylamino)-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 68997048 |
| Molecular Formula | C20H30FNO |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (8R,9R,10R,13S,14S)-16-fluoro-10,13-dimethyl-17-(methylamino)-6,7,8,9,11,12,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CNC1C(F)C[C@H]2[C@@H]3CCC4=CC(O)C=C[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C20H30FNO/c1-19-8-6-13(23)10-12(19)4-5-14-15(19)7-9-20(2)16(14)11-17(21)18(20)22-3/h6,8,10,13-18,22-23H,4-5,7,9,11H2,1-3H3/t13?,14-,15-,16+,17?,18?,19+,20+/m1/s1 |
| InChIKey | RXZWMWLLSMREHK-ZAPUIHEKSA-N |
| XLogP | 3.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|