C19H26O — CID 154342588
(3R,8S,9S,10R,13R,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-3-ol (PubChem CID 154342588) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (3R,8S,9S,10R,13R,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8S,9S,10R,13R,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 154342588 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (3R,8S,9S,10R,13R,14S)-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@]12C=CC[C@H]1[C@@H]1CCC3=C[C@H](O)C=C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H26O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,7,9,11-12,14-17,20H,4-6,8,10H2,1-2H3/t14-,15+,16+,17+,18+,19+/m1/s1 |
| InChIKey | XOVCYXHQJVVPTJ-UGCZWRCOSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|