C19H30O2 — CID 12020354
(3S,5R,8S,9S,10R,13R,14S)-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,5-diol (PubChem CID 12020354) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (3S,5R,8S,9S,10R,13R,14S)-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,5-diol.
| Compound Name | (3S,5R,8S,9S,10R,13R,14S)-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,5-diol |
|---|---|
| PubChem CID | 12020354 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (3S,5R,8S,9S,10R,13R,14S)-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-3,5-diol |
| SMILES | C[C@@]12C=CC[C@H]1[C@@H]1CC[C@@]3(O)C[C@@H](O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H30O2/c1-17-8-3-4-15(17)14-6-11-19(21)12-13(20)5-10-18(19,2)16(14)7-9-17/h3,8,13-16,20-21H,4-7,9-12H2,1-2H3/t13-,14-,15-,16-,17-,18+,19+/m0/s1 |
| InChIKey | WWRSJEDVDHCIOI-UYYZUGKPSA-N |
| XLogP | 3.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|