C23H40O3 — CID 57010963
(8R,9R,10R,13S,14R)-15,16-diethyl-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,17-triol (PubChem CID 57010963) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is (8R,9R,10R,13S,14R)-15,16-diethyl-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,17-triol.
| Compound Name | (8R,9R,10R,13S,14R)-15,16-diethyl-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,17-triol |
|---|---|
| PubChem CID | 57010963 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | (8R,9R,10R,13S,14R)-15,16-diethyl-10,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,5,17-triol |
| SMILES | CCC1C(CC)[C@H]2[C@@H]3CCC4(O)CC(O)CC[C@]4(C)[C@@H]3CC[C@]2(C)C1O |
| InChI | InChI=1S/C23H40O3/c1-5-15-16(6-2)20(25)21(3)10-9-18-17(19(15)21)8-12-23(26)13-14(24)7-11-22(18,23)4/h14-20,24-26H,5-13H2,1-4H3/t14?,15?,16?,17-,18-,19+,20?,21+,22-,23?/m1/s1 |
| InChIKey | FDKOPQTZSILWHU-PFLNLEHNSA-N |
| XLogP | 4.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |